C29H30FN3O5 — CID 163435288
(6R,6aR)-6-[[5-[4-[4-[2-(dimethylamino)ethoxy]phenyl]phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 163435288) has the molecular formula C29H30FN3O5 and a molecular weight of 519.57 g/mol. Its IUPAC name is (6R,6aR)-6-[[5-[4-[4-[2-(dimethylamino)ethoxy]phenyl]phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (6R,6aR)-6-[[5-[4-[4-[2-(dimethylamino)ethoxy]phenyl]phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 163435288 |
| Molecular Formula | C29H30FN3O5 |
| Molecular Weight | 519.57 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | (6R,6aR)-6-[[5-[4-[4-[2-(dimethylamino)ethoxy]phenyl]phenyl]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CN(C)CCOc1ccc(-c2ccc(-c3nc4cc(O[C@@H]5COC6C(O)CO[C@@H]65)[nH]c4cc3F)cc2)cc1 |
| InChI | InChI=1S/C29H30FN3O5/c1-33(2)11-12-35-20-9-7-18(8-10-20)17-3-5-19(6-4-17)27-21(30)13-22-23(32-27)14-26(31-22)38-25-16-37-28-24(34)15-36-29(25)28/h3-10,13-14,24-25,28-29,31,34H,11-12,15-16H2,1-2H3/t24?,25-,28?,29-/m1/s1 |
| InChIKey | ATZBDMCUNNJPRG-IZMMRECYSA-N |
| XLogP | 3.88 |
| TPSA | 89.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.57 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |