C28H27ClN2O6 — CID 166813384
6-[[6-chloro-5-[4-[4-(1-hydroxypropan-2-yloxy)phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 166813384) has the molecular formula C28H27ClN2O6 and a molecular weight of 522.99 g/mol. Its IUPAC name is 6-[[6-chloro-5-[4-[4-(1-hydroxypropan-2-yloxy)phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | 6-[[6-chloro-5-[4-[4-(1-hydroxypropan-2-yloxy)phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 166813384 |
| Molecular Formula | C28H27ClN2O6 |
| Molecular Weight | 522.99 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | 6-[[6-chloro-5-[4-[4-(1-hydroxypropan-2-yloxy)phenyl]phenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | CC(CO)Oc1ccc(-c2ccc(-c3nc4cc(OC5COC6C(O)COC56)[nH]c4cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C28H27ClN2O6/c1-15(12-32)36-19-8-6-17(7-9-19)16-2-4-18(5-3-16)26-20(29)10-21-22(31-26)11-25(30-21)37-24-14-35-27-23(33)13-34-28(24)27/h2-11,15,23-24,27-28,30,32-33H,12-14H2,1H3 |
| InChIKey | PFQPXACCYYZDTD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.99 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |