C26H21N3O4 — CID 118908635
2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-(4-phenylphenyl)-1H-pyrrolo[3,2-b]pyridine-6-carbonitrile (PubChem CID 118908635) has the molecular formula C26H21N3O4 and a molecular weight of 439.47 g/mol. Its IUPAC name is 2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-(4-phenylphenyl)-1H-pyrrolo[3,2-b]pyridine-6-carbonitrile.
| Compound Name | 2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-(4-phenylphenyl)-1H-pyrrolo[3,2-b]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 118908635 |
| Molecular Formula | C26H21N3O4 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-5-(4-phenylphenyl)-1H-pyrrolo[3,2-b]pyridine-6-carbonitrile |
| SMILES | N#Cc1cc2[nH]c(O[C@@H]3CO[C@H]4[C@@H]3OC[C@H]4O)cc2nc1-c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H21N3O4/c27-12-18-10-19-20(11-23(28-19)33-22-14-32-25-21(30)13-31-26(22)25)29-24(18)17-8-6-16(7-9-17)15-4-2-1-3-5-15/h1-11,21-22,25-26,28,30H,13-14H2/t21-,22-,25-,26-/m1/s1 |
| InChIKey | YYPBQPBZJAPFCO-SAZLYLDSSA-N |
| XLogP | 3.67 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |