C24H25FN2O7 — CID 118908657
(3R,4S,6R)-6-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]oxane-3,4-diol (PubChem CID 118908657) has the molecular formula C24H25FN2O7 and a molecular weight of 472.47 g/mol. Its IUPAC name is (3R,4S,6R)-6-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]oxane-3,4-diol.
| Compound Name | (3R,4S,6R)-6-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]oxane-3,4-diol |
|---|---|
| PubChem CID | 118908657 |
| Molecular Formula | C24H25FN2O7 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | (3R,4S,6R)-6-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]oxane-3,4-diol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1cc2nc(-c3ccc([C@H]4C[C@H](O)[C@H](O)CO4)cc3)c(F)cc2[nH]1 |
| InChI | InChI=1S/C24H25FN2O7/c25-13-5-14-15(6-21(26-14)34-20-10-33-23-18(30)9-32-24(20)23)27-22(13)12-3-1-11(2-4-12)19-7-16(28)17(29)8-31-19/h1-6,16-20,23-24,26,28-30H,7-10H2/t16-,17+,18+,19+,20+,23+,24+/m0/s1 |
| InChIKey | WIRRDLUMMYZHLI-WAQQOCIBSA-N |
| XLogP | 1.46 |
| TPSA | 126.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |