C26H28FN3O5 — CID 118908842
1-[2-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]piperidin-1-yl]ethanone (PubChem CID 118908842) has the molecular formula C26H28FN3O5 and a molecular weight of 481.52 g/mol. Its IUPAC name is 1-[2-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[2-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 118908842 |
| Molecular Formula | C26H28FN3O5 |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 1-[2-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1H-pyrrolo[3,2-b]pyridin-5-yl]phenyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCCCC1c1ccc(-c2nc3cc(O[C@@H]4CO[C@H]5[C@@H]4OC[C@H]5O)[nH]c3cc2F)cc1 |
| InChI | InChI=1S/C26H28FN3O5/c1-14(31)30-9-3-2-4-20(30)15-5-7-16(8-6-15)24-17(27)10-18-19(29-24)11-23(28-18)35-22-13-34-25-21(32)12-33-26(22)25/h5-8,10-11,20-22,25-26,28,32H,2-4,9,12-13H2,1H3/t20?,21-,22-,25-,26-/m1/s1 |
| InChIKey | RXTBADCMKGEFRJ-NGUJMDQRSA-N |
| XLogP | 3.35 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |