C31H28F4N2O8S — CID 130378193
[4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1-(oxan-2-yl)pyrrolo[3,2-b]pyridin-5-yl]phenyl]phenyl] trifluoromethanesulfonate (PubChem CID 130378193) has the molecular formula C31H28F4N2O8S and a molecular weight of 664.63 g/mol. Its IUPAC name is [4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1-(oxan-2-yl)pyrrolo[3,2-b]pyridin-5-yl]phenyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1-(oxan-2-yl)pyrrolo[3,2-b]pyridin-5-yl]phenyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 130378193 |
| Molecular Formula | C31H28F4N2O8S |
| Molecular Weight | 664.63 g/mol |
| Exact Mass | 664.15 |
| IUPAC Name | [4-[4-[2-[[(3R,3aR,6R,6aR)-3-hydroxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-6-fluoro-1-(oxan-2-yl)pyrrolo[3,2-b]pyridin-5-yl]phenyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2ccc(-c3nc4cc(O[C@@H]5CO[C@H]6[C@@H]5OC[C@H]6O)n(C5CCCCO5)c4cc3F)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C31H28F4N2O8S/c32-21-13-23-22(14-27(37(23)26-3-1-2-12-41-26)44-25-16-43-29-24(38)15-42-30(25)29)36-28(21)19-6-4-17(5-7-19)18-8-10-20(11-9-18)45-46(39,40)31(33,34)35/h4-11,13-14,24-26,29-30,38H,1-3,12,15-16H2/t24-,25-,26?,29-,30-/m1/s1 |
| InChIKey | WNNGGFRUYPDAIY-BHFDZPIZSA-N |
| XLogP | 5.34 |
| TPSA | 118.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.63 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|