C7H2Br2F2N2S — CID 178060639
(2,5-dibromo-6-fluoropyrrolo[3,2-b]pyridin-1-yl) thiohypofluorite (PubChem CID 178060639) has the molecular formula C7H2Br2F2N2S and a molecular weight of 343.98 g/mol. Its IUPAC name is (2,5-dibromo-6-fluoropyrrolo[3,2-b]pyridin-1-yl) thiohypofluorite.
| Compound Name | (2,5-dibromo-6-fluoropyrrolo[3,2-b]pyridin-1-yl) thiohypofluorite |
|---|---|
| PubChem CID | 178060639 |
| Molecular Formula | C7H2Br2F2N2S |
| Molecular Weight | 343.98 g/mol |
| Exact Mass | 341.83 |
| IUPAC Name | (2,5-dibromo-6-fluoropyrrolo[3,2-b]pyridin-1-yl) thiohypofluorite |
| SMILES | FSn1c(Br)cc2nc(Br)c(F)cc21 |
| InChI | InChI=1S/C7H2Br2F2N2S/c8-6-2-4-5(13(6)14-11)1-3(10)7(9)12-4/h1-2H |
| InChIKey | BNBHAHGDDPUZQD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.98 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|