C5HBrF2IN — CID 177159493
2-bromo-3,5-difluoro-6-iodopyridine (PubChem CID 177159493) has the molecular formula C5HBrF2IN and a molecular weight of 319.87 g/mol. Its IUPAC name is 2-bromo-3,5-difluoro-6-iodopyridine.
| Compound Name | 2-bromo-3,5-difluoro-6-iodopyridine |
|---|---|
| PubChem CID | 177159493 |
| Molecular Formula | C5HBrF2IN |
| Molecular Weight | 319.87 g/mol |
| Exact Mass | 318.83 |
| IUPAC Name | 2-bromo-3,5-difluoro-6-iodopyridine |
| SMILES | Fc1cc(F)c(I)nc1Br |
| InChI | InChI=1S/C5HBrF2IN/c6-4-2(7)1-3(8)5(9)10-4/h1H |
| InChIKey | MNIYEISVOZBFGE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.87 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|