C35H39N3O2Si — CID 162712956
trimethyl-[2-[[5-phenyl-2-(7-phenylmethoxy-3,4-dihydro-1H-isoquinolin-2-yl)benzimidazol-1-yl]methoxy]ethyl]silane (PubChem CID 162712956) has the molecular formula C35H39N3O2Si and a molecular weight of 561.80 g/mol. Its IUPAC name is trimethyl-[2-[[5-phenyl-2-(7-phenylmethoxy-3,4-dihydro-1H-isoquinolin-2-yl)benzimidazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-phenyl-2-(7-phenylmethoxy-3,4-dihydro-1H-isoquinolin-2-yl)benzimidazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 162712956 |
| Molecular Formula | C35H39N3O2Si |
| Molecular Weight | 561.80 g/mol |
| Exact Mass | 561.28 |
| IUPAC Name | trimethyl-[2-[[5-phenyl-2-(7-phenylmethoxy-3,4-dihydro-1H-isoquinolin-2-yl)benzimidazol-1-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1c(N2CCc3ccc(OCc4ccccc4)cc3C2)nc2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C35H39N3O2Si/c1-41(2,3)21-20-39-26-38-34-17-15-30(28-12-8-5-9-13-28)23-33(34)36-35(38)37-19-18-29-14-16-32(22-31(29)24-37)40-25-27-10-6-4-7-11-27/h4-17,22-23H,18-21,24-26H2,1-3H3 |
| InChIKey | LIPNTSLMPAJTMZ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.80 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|