C15H19F3N4O2Si — CID 175892649
3-[5-(trifluoromethyl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyridine-2-carbaldehyde (PubChem CID 175892649) has the molecular formula C15H19F3N4O2Si and a molecular weight of 372.42 g/mol. Its IUPAC name is 3-[5-(trifluoromethyl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyridine-2-carbaldehyde.
| Compound Name | 3-[5-(trifluoromethyl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 175892649 |
| Molecular Formula | C15H19F3N4O2Si |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3-[5-(trifluoromethyl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyridine-2-carbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1c(-c2cccnc2C=O)nnc1C(F)(F)F |
| InChI | InChI=1S/C15H19F3N4O2Si/c1-25(2,3)8-7-24-10-22-13(20-21-14(22)15(16,17)18)11-5-4-6-19-12(11)9-23/h4-6,9H,7-8,10H2,1-3H3 |
| InChIKey | LJKAZBKBLFOFQZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|