C18H28F3N5O2Si — CID 175927146
N-(2-methoxyethyl)-2-methyl-5-[5-(trifluoromethyl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyridin-3-amine (PubChem CID 175927146) has the molecular formula C18H28F3N5O2Si and a molecular weight of 431.54 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-methyl-5-[5-(trifluoromethyl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyridin-3-amine.
| Compound Name | N-(2-methoxyethyl)-2-methyl-5-[5-(trifluoromethyl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyridin-3-amine |
|---|---|
| PubChem CID | 175927146 |
| Molecular Formula | C18H28F3N5O2Si |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | N-(2-methoxyethyl)-2-methyl-5-[5-(trifluoromethyl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]pyridin-3-amine |
| SMILES | COCCNc1cc(-c2nnc(C(F)(F)F)n2COCC[Si](C)(C)C)cnc1C |
| InChI | InChI=1S/C18H28F3N5O2Si/c1-13-15(22-6-7-27-2)10-14(11-23-13)16-24-25-17(18(19,20)21)26(16)12-28-8-9-29(3,4)5/h10-11,22H,6-9,12H2,1-5H3 |
| InChIKey | ZHKBMUPLMAVYEM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|