C18H22Cl2N4O3Si — CID 90402484
8-chloro-7-[(4-chlorophenyl)methyl]-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 90402484) has the molecular formula C18H22Cl2N4O3Si and a molecular weight of 441.39 g/mol. Its IUPAC name is 8-chloro-7-[(4-chlorophenyl)methyl]-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 8-chloro-7-[(4-chlorophenyl)methyl]-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 90402484 |
| Molecular Formula | C18H22Cl2N4O3Si |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | 8-chloro-7-[(4-chlorophenyl)methyl]-3-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | C[Si](C)(C)CCOCn1c(=O)[nH]c(=O)c2c1nc(Cl)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H22Cl2N4O3Si/c1-28(2,3)9-8-27-11-24-15-14(16(25)22-18(24)26)23(17(20)21-15)10-12-4-6-13(19)7-5-12/h4-7H,8-11H2,1-3H3,(H,22,25,26) |
| InChIKey | AZTDFEVFCCYJKT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|