C16H27BrN4O4Si — CID 90425724
8-(4-bromo-3-hydroxybutyl)-3-methyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione (PubChem CID 90425724) has the molecular formula C16H27BrN4O4Si and a molecular weight of 447.41 g/mol. Its IUPAC name is 8-(4-bromo-3-hydroxybutyl)-3-methyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione.
| Compound Name | 8-(4-bromo-3-hydroxybutyl)-3-methyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
|---|---|
| PubChem CID | 90425724 |
| Molecular Formula | C16H27BrN4O4Si |
| Molecular Weight | 447.41 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | 8-(4-bromo-3-hydroxybutyl)-3-methyl-7-(2-trimethylsilylethoxymethyl)purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2c1nc(CCC(O)CBr)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H27BrN4O4Si/c1-20-14-13(15(23)19-16(20)24)21(10-25-7-8-26(2,3)4)12(18-14)6-5-11(22)9-17/h11,22H,5-10H2,1-4H3,(H,19,23,24) |
| InChIKey | INUAXUWDWPHALH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.41 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|