C14H12Cl2N4O3 — CID 135269161
8-chloro-7-[(4-chlorophenyl)methyl]-3-ethyl-1-hydroxypurine-2,6-dione (PubChem CID 135269161) has the molecular formula C14H12Cl2N4O3 and a molecular weight of 355.18 g/mol. Its IUPAC name is 8-chloro-7-[(4-chlorophenyl)methyl]-3-ethyl-1-hydroxypurine-2,6-dione.
| Compound Name | 8-chloro-7-[(4-chlorophenyl)methyl]-3-ethyl-1-hydroxypurine-2,6-dione |
|---|---|
| PubChem CID | 135269161 |
| Molecular Formula | C14H12Cl2N4O3 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 8-chloro-7-[(4-chlorophenyl)methyl]-3-ethyl-1-hydroxypurine-2,6-dione |
| SMILES | CCn1c(=O)n(O)c(=O)c2c1nc(Cl)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H12Cl2N4O3/c1-2-18-11-10(12(21)20(23)14(18)22)19(13(16)17-11)7-8-3-5-9(15)6-4-8/h3-6,23H,2,7H2,1H3 |
| InChIKey | FBCZNRMKQSCMMB-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|