C26H30ClFN6O4Si — CID 90218386
2-[(5-chloro-2-methoxy-3-pyridinyl)amino]-9-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-7-(2-trimethylsilylethoxymethyl)purin-8-one (PubChem CID 90218386) has the molecular formula C26H30ClFN6O4Si and a molecular weight of 573.10 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxy-3-pyridinyl)amino]-9-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-7-(2-trimethylsilylethoxymethyl)purin-8-one.
| Compound Name | 2-[(5-chloro-2-methoxy-3-pyridinyl)amino]-9-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-7-(2-trimethylsilylethoxymethyl)purin-8-one |
|---|---|
| PubChem CID | 90218386 |
| Molecular Formula | C26H30ClFN6O4Si |
| Molecular Weight | 573.10 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 2-[(5-chloro-2-methoxy-3-pyridinyl)amino]-9-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-7-(2-trimethylsilylethoxymethyl)purin-8-one |
| SMILES | COc1ncc(Cl)cc1Nc1ncc2c(n1)n(C1CCOc3c(F)cccc31)c(=O)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H30ClFN6O4Si/c1-36-24-19(12-16(27)13-29-24)31-25-30-14-21-23(32-25)34(26(35)33(21)15-37-10-11-39(2,3)4)20-8-9-38-22-17(20)6-5-7-18(22)28/h5-7,12-14,20H,8-11,15H2,1-4H3,(H,30,31,32) |
| InChIKey | PVWOODVJXCVGIN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.10 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|