C24H30FN7O3Si — CID 90218214
9-[1-(5-fluoro-2-pyridinyl)ethyl]-2-[(2-methoxy-3-pyridinyl)amino]-7-(2-trimethylsilylethoxymethyl)purin-8-one (PubChem CID 90218214) has the molecular formula C24H30FN7O3Si and a molecular weight of 511.63 g/mol. Its IUPAC name is 9-[1-(5-fluoro-2-pyridinyl)ethyl]-2-[(2-methoxy-3-pyridinyl)amino]-7-(2-trimethylsilylethoxymethyl)purin-8-one.
| Compound Name | 9-[1-(5-fluoro-2-pyridinyl)ethyl]-2-[(2-methoxy-3-pyridinyl)amino]-7-(2-trimethylsilylethoxymethyl)purin-8-one |
|---|---|
| PubChem CID | 90218214 |
| Molecular Formula | C24H30FN7O3Si |
| Molecular Weight | 511.63 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | 9-[1-(5-fluoro-2-pyridinyl)ethyl]-2-[(2-methoxy-3-pyridinyl)amino]-7-(2-trimethylsilylethoxymethyl)purin-8-one |
| SMILES | COc1ncccc1Nc1ncc2c(n1)n(C(C)c1ccc(F)cn1)c(=O)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C24H30FN7O3Si/c1-16(18-9-8-17(25)13-27-18)32-21-20(31(24(32)33)15-35-11-12-36(3,4)5)14-28-23(30-21)29-19-7-6-10-26-22(19)34-2/h6-10,13-14,16H,11-12,15H2,1-5H3,(H,28,29,30) |
| InChIKey | ZCLJCENVVSPFHQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.63 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|