C25H29N7O2Si — CID 70650283
9-[(1R)-1-phenylethyl]-2-pyrazolo[1,5-a]pyrazin-3-yl-7-(2-trimethylsilylethoxymethyl)purin-8-one (PubChem CID 70650283) has the molecular formula C25H29N7O2Si and a molecular weight of 487.64 g/mol. Its IUPAC name is 9-[(1R)-1-phenylethyl]-2-pyrazolo[1,5-a]pyrazin-3-yl-7-(2-trimethylsilylethoxymethyl)purin-8-one.
| Compound Name | 9-[(1R)-1-phenylethyl]-2-pyrazolo[1,5-a]pyrazin-3-yl-7-(2-trimethylsilylethoxymethyl)purin-8-one |
|---|---|
| PubChem CID | 70650283 |
| Molecular Formula | C25H29N7O2Si |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 9-[(1R)-1-phenylethyl]-2-pyrazolo[1,5-a]pyrazin-3-yl-7-(2-trimethylsilylethoxymethyl)purin-8-one |
| SMILES | C[C@H](c1ccccc1)n1c(=O)n(COCC[Si](C)(C)C)c2cnc(-c3cnn4ccncc34)nc21 |
| InChI | InChI=1S/C25H29N7O2Si/c1-18(19-8-6-5-7-9-19)32-24-22(30(25(32)33)17-34-12-13-35(2,3)4)16-27-23(29-24)20-14-28-31-11-10-26-15-21(20)31/h5-11,14-16,18H,12-13,17H2,1-4H3/t18-/m1/s1 |
| InChIKey | HMPUQINAHIKTBK-GOSISDBHSA-N |
| XLogP | 4.22 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|