C17H20BrFN4OSi — CID 164881021
2-[[7-bromo-2-(2-fluoro-3-pyridinyl)pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 164881021) has the molecular formula C17H20BrFN4OSi and a molecular weight of 423.36 g/mol. Its IUPAC name is 2-[[7-bromo-2-(2-fluoro-3-pyridinyl)pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[7-bromo-2-(2-fluoro-3-pyridinyl)pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 164881021 |
| Molecular Formula | C17H20BrFN4OSi |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 2-[[7-bromo-2-(2-fluoro-3-pyridinyl)pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1cc(Br)c2nc(-c3cccnc3F)ncc21 |
| InChI | InChI=1S/C17H20BrFN4OSi/c1-25(2,3)8-7-24-11-23-10-13(18)15-14(23)9-21-17(22-15)12-5-4-6-20-16(12)19/h4-6,9-10H,7-8,11H2,1-3H3 |
| InChIKey | UJWXLOHSGHVUQT-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|