C19H23F3N4O2Si — CID 164880991
trimethyl-[2-[[2-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl]silane (PubChem CID 164880991) has the molecular formula C19H23F3N4O2Si and a molecular weight of 424.50 g/mol. Its IUPAC name is trimethyl-[2-[[2-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[2-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 164880991 |
| Molecular Formula | C19H23F3N4O2Si |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | trimethyl-[2-[[2-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl]silane |
| SMILES | C[Si](C)(C)CCOCn1ccc2nc(-c3cccnc3OCC(F)(F)F)ncc21 |
| InChI | InChI=1S/C19H23F3N4O2Si/c1-29(2,3)10-9-27-13-26-8-6-15-16(26)11-24-17(25-15)14-5-4-7-23-18(14)28-12-19(20,21)22/h4-8,11H,9-10,12-13H2,1-3H3 |
| InChIKey | VCAMYVVNWVSIKT-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|