C20H25F2N5O2Si — CID 164881265
2-[[2-[4-(2,2-difluorocyclopropyl)-6-methoxypyrimidin-5-yl]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 164881265) has the molecular formula C20H25F2N5O2Si and a molecular weight of 433.54 g/mol. Its IUPAC name is 2-[[2-[4-(2,2-difluorocyclopropyl)-6-methoxypyrimidin-5-yl]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-[4-(2,2-difluorocyclopropyl)-6-methoxypyrimidin-5-yl]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 164881265 |
| Molecular Formula | C20H25F2N5O2Si |
| Molecular Weight | 433.54 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-[[2-[4-(2,2-difluorocyclopropyl)-6-methoxypyrimidin-5-yl]pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1ncnc(C2CC2(F)F)c1-c1ncc2c(ccn2COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C20H25F2N5O2Si/c1-28-19-16(17(24-11-25-19)13-9-20(13,21)22)18-23-10-15-14(26-18)5-6-27(15)12-29-7-8-30(2,3)4/h5-6,10-11,13H,7-9,12H2,1-4H3 |
| InChIKey | ANJXCDNGYQWBBZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.54 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|