C20H28N6O2Si — CID 164881022
2-[[5-(4-cyclopropyl-6-methoxy-2-methylpyrimidin-5-yl)pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 164881022) has the molecular formula C20H28N6O2Si and a molecular weight of 412.57 g/mol. Its IUPAC name is 2-[[5-(4-cyclopropyl-6-methoxy-2-methylpyrimidin-5-yl)pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(4-cyclopropyl-6-methoxy-2-methylpyrimidin-5-yl)pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 164881022 |
| Molecular Formula | C20H28N6O2Si |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[[5-(4-cyclopropyl-6-methoxy-2-methylpyrimidin-5-yl)pyrazolo[4,3-d]pyrimidin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1nc(C)nc(C2CC2)c1-c1ncc2c(cnn2COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C20H28N6O2Si/c1-13-23-18(14-6-7-14)17(20(24-13)27-2)19-21-11-16-15(25-19)10-22-26(16)12-28-8-9-29(3,4)5/h10-11,14H,6-9,12H2,1-5H3 |
| InChIKey | NKLZWQQOKLCQRH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 87.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|