C21H29N5O2Si — CID 164881436
2-[[2-(4-cyclopropyl-6-ethoxypyrimidin-5-yl)pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane (PubChem CID 164881436) has the molecular formula C21H29N5O2Si and a molecular weight of 411.58 g/mol. Its IUPAC name is 2-[[2-(4-cyclopropyl-6-ethoxypyrimidin-5-yl)pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[2-(4-cyclopropyl-6-ethoxypyrimidin-5-yl)pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 164881436 |
| Molecular Formula | C21H29N5O2Si |
| Molecular Weight | 411.58 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | 2-[[2-(4-cyclopropyl-6-ethoxypyrimidin-5-yl)pyrrolo[3,2-d]pyrimidin-5-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CCOc1ncnc(C2CC2)c1-c1ncc2c(ccn2COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C21H29N5O2Si/c1-5-28-21-18(19(15-6-7-15)23-13-24-21)20-22-12-17-16(25-20)8-9-26(17)14-27-10-11-29(2,3)4/h8-9,12-13,15H,5-7,10-11,14H2,1-4H3 |
| InChIKey | IWOYSJINVFHCPQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|