C20H26BrN5O2Si — CID 164881012
2-[[3-bromo-5-(4-cyclopropyl-6-methoxypyrimidin-5-yl)pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 164881012) has the molecular formula C20H26BrN5O2Si and a molecular weight of 476.45 g/mol. Its IUPAC name is 2-[[3-bromo-5-(4-cyclopropyl-6-methoxypyrimidin-5-yl)pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[3-bromo-5-(4-cyclopropyl-6-methoxypyrimidin-5-yl)pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 164881012 |
| Molecular Formula | C20H26BrN5O2Si |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 475.10 |
| IUPAC Name | 2-[[3-bromo-5-(4-cyclopropyl-6-methoxypyrimidin-5-yl)pyrazolo[3,4-c]pyridin-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | COc1ncnc(C2CC2)c1-c1cc2c(Br)nn(COCC[Si](C)(C)C)c2cn1 |
| InChI | InChI=1S/C20H26BrN5O2Si/c1-27-20-17(18(13-5-6-13)23-11-24-20)15-9-14-16(10-22-15)26(25-19(14)21)12-28-7-8-29(2,3)4/h9-11,13H,5-8,12H2,1-4H3 |
| InChIKey | GMLNZJIGHGKWLO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|