C27H36ClN5O4Si — CID 23551841
methyl N-[4-[[6-(2-chlorophenyl)-7-oxo-8-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate (PubChem CID 23551841) has the molecular formula C27H36ClN5O4Si and a molecular weight of 558.16 g/mol. Its IUPAC name is methyl N-[4-[[6-(2-chlorophenyl)-7-oxo-8-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate.
| Compound Name | methyl N-[4-[[6-(2-chlorophenyl)-7-oxo-8-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 23551841 |
| Molecular Formula | C27H36ClN5O4Si |
| Molecular Weight | 558.16 g/mol |
| Exact Mass | 557.22 |
| IUPAC Name | methyl N-[4-[[6-(2-chlorophenyl)-7-oxo-8-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate |
| SMILES | COC(=O)NC1CCC(Nc2ncc3cc(-c4ccccc4Cl)c(=O)n(COCC[Si](C)(C)C)c3n2)CC1 |
| InChI | InChI=1S/C27H36ClN5O4Si/c1-36-27(35)31-20-11-9-19(10-12-20)30-26-29-16-18-15-22(21-7-5-6-8-23(21)28)25(34)33(24(18)32-26)17-37-13-14-38(2,3)4/h5-8,15-16,19-20H,9-14,17H2,1-4H3,(H,31,35)(H,29,30,32) |
| InChIKey | FOWMKYHEZUBKJY-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.16 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|