C26H35ClN6O3Si — CID 23551739
[4-[[6-(2-chlorophenyl)-7-oxo-8-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]urea (PubChem CID 23551739) has the molecular formula C26H35ClN6O3Si and a molecular weight of 543.14 g/mol. Its IUPAC name is [4-[[6-(2-chlorophenyl)-7-oxo-8-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]urea.
| Compound Name | [4-[[6-(2-chlorophenyl)-7-oxo-8-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]urea |
|---|---|
| PubChem CID | 23551739 |
| Molecular Formula | C26H35ClN6O3Si |
| Molecular Weight | 543.14 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | [4-[[6-(2-chlorophenyl)-7-oxo-8-(2-trimethylsilylethoxymethyl)pyrido[2,3-d]pyrimidin-2-yl]amino]cyclohexyl]urea |
| SMILES | C[Si](C)(C)CCOCn1c(=O)c(-c2ccccc2Cl)cc2cnc(NC3CCC(NC(N)=O)CC3)nc21 |
| InChI | InChI=1S/C26H35ClN6O3Si/c1-37(2,3)13-12-36-16-33-23-17(14-21(24(33)34)20-6-4-5-7-22(20)27)15-29-26(32-23)31-19-10-8-18(9-11-19)30-25(28)35/h4-7,14-15,18-19H,8-13,16H2,1-3H3,(H3,28,30,35)(H,29,31,32) |
| InChIKey | RDDSSKRXOOFVBE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.14 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|