C25H35N3O — CID 163203344
2,6-dicyclohexyl-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 163203344) has the molecular formula C25H35N3O and a molecular weight of 393.58 g/mol. Its IUPAC name is 2,6-dicyclohexyl-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2,6-dicyclohexyl-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 163203344 |
| Molecular Formula | C25H35N3O |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.28 |
| IUPAC Name | 2,6-dicyclohexyl-8-cyclopentyl-5-methylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1c(C2CCCCC2)c(=O)n(C2CCCC2)c2nc(C3CCCCC3)ncc12 |
| InChI | InChI=1S/C25H35N3O/c1-17-21-16-26-23(19-12-6-3-7-13-19)27-24(21)28(20-14-8-9-15-20)25(29)22(17)18-10-4-2-5-11-18/h16,18-20H,2-15H2,1H3 |
| InChIKey | NVBZWBMHFWSOJZ-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |