C14H16IN3OS — CID 11395497
8-cyclopentyl-6-iodo-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one (PubChem CID 11395497) has the molecular formula C14H16IN3OS and a molecular weight of 401.27 g/mol. Its IUPAC name is 8-cyclopentyl-6-iodo-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-6-iodo-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 11395497 |
| Molecular Formula | C14H16IN3OS |
| Molecular Weight | 401.27 g/mol |
| Exact Mass | 401.01 |
| IUPAC Name | 8-cyclopentyl-6-iodo-5-methyl-2-methylsulfanylpyrido[2,3-d]pyrimidin-7-one |
| SMILES | CSc1ncc2c(C)c(I)c(=O)n(C3CCCC3)c2n1 |
| InChI | InChI=1S/C14H16IN3OS/c1-8-10-7-16-14(20-2)17-12(10)18(13(19)11(8)15)9-5-3-4-6-9/h7,9H,3-6H2,1-2H3 |
| InChIKey | KEOXLZVYFKHZRX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.27 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|