C21H24N6OS — CID 143392943
5-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-[(1S)-2-methylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 143392943) has the molecular formula C21H24N6OS and a molecular weight of 408.53 g/mol. Its IUPAC name is 5-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-[(1S)-2-methylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 5-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-[(1S)-2-methylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 143392943 |
| Molecular Formula | C21H24N6OS |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 5-[(5-cyclopropyl-1,3,4-thiadiazol-2-yl)methyl]-3-[(1S)-2-methylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | CC1CCCC[C@@H]1n1c(=O)n(Cc2nnc(C3CC3)s2)c2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C21H24N6OS/c1-12-4-2-3-5-15(12)27-18-14-8-9-22-19(14)23-10-16(18)26(21(27)28)11-17-24-25-20(29-17)13-6-7-13/h8-10,12-13,15H,2-7,11H2,1H3,(H,22,23)/t12?,15-/m0/s1 |
| InChIKey | ZJHOMZVLONSQNX-CVRLYYSRSA-N |
| XLogP | 4.21 |
| TPSA | 81.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |