C25H28N4O3 — CID 71221952
5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[(2R)-2-methylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one (PubChem CID 71221952) has the molecular formula C25H28N4O3 and a molecular weight of 432.52 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[(2R)-2-methylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one.
| Compound Name | 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[(2R)-2-methylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
|---|---|
| PubChem CID | 71221952 |
| Molecular Formula | C25H28N4O3 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.22 |
| IUPAC Name | 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylmethyl)-3-[(2R)-2-methylcyclohexyl]-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,6,8,11-tetraen-4-one |
| SMILES | C[C@@H]1CCCCC1n1c(=O)n(Cc2ccc3c(c2)OCCCO3)c2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C25H28N4O3/c1-16-5-2-3-6-19(16)29-23-18-9-10-26-24(18)27-14-20(23)28(25(29)30)15-17-7-8-21-22(13-17)32-12-4-11-31-21/h7-10,13-14,16,19H,2-6,11-12,15H2,1H3,(H,26,27)/t16-,19?/m1/s1 |
| InChIKey | GZERZFRLCZZRTH-VTBWFHPJSA-N |
| XLogP | 4.64 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |