C33H50N4O3Si — CID 172849201
1-[1-[2-(4-tert-butylcyclohexyl)-2-oxoethyl]piperidin-2-yl]-2-(2-trimethylsilylethoxymethyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one (PubChem CID 172849201) has the molecular formula C33H50N4O3Si and a molecular weight of 578.87 g/mol. Its IUPAC name is 1-[1-[2-(4-tert-butylcyclohexyl)-2-oxoethyl]piperidin-2-yl]-2-(2-trimethylsilylethoxymethyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one.
| Compound Name | 1-[1-[2-(4-tert-butylcyclohexyl)-2-oxoethyl]piperidin-2-yl]-2-(2-trimethylsilylethoxymethyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one |
|---|---|
| PubChem CID | 172849201 |
| Molecular Formula | C33H50N4O3Si |
| Molecular Weight | 578.87 g/mol |
| Exact Mass | 578.37 |
| IUPAC Name | 1-[1-[2-(4-tert-butylcyclohexyl)-2-oxoethyl]piperidin-2-yl]-2-(2-trimethylsilylethoxymethyl)-7H-pyrrolo[2,3-h][1,6]naphthyridin-4-one |
| SMILES | CC(C)(C)C1CCC(C(=O)CN2CCCCC2n2c(COCC[Si](C)(C)C)cc(=O)c3cnc4[nH]ccc4c32)CC1 |
| InChI | InChI=1S/C33H50N4O3Si/c1-33(2,3)24-12-10-23(11-13-24)29(39)21-36-16-8-7-9-30(36)37-25(22-40-17-18-41(4,5)6)19-28(38)27-20-35-32-26(31(27)37)14-15-34-32/h14-15,19-20,23-24,30H,7-13,16-18,21-22H2,1-6H3,(H,34,35) |
| InChIKey | XVKWDSMOOHKFEV-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 80.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.87 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|