C16H26BrN5O2Si — CID 140776898
trans-(1R,2R)-2-[[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]cyclopentan-1-ol (PubChem CID 140776898) has the molecular formula C16H26BrN5O2Si and a molecular weight of 428.41 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-[[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 140776898 |
| Molecular Formula | C16H26BrN5O2Si |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | trans-(1R,2R)-2-[[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidin-4-yl]amino]cyclopentan-1-ol |
| SMILES | C[Si](C)(C)CCOCn1nc(Br)c2c(N[C@@H]3CCC[C@H]3O)ncnc21 |
| InChI | InChI=1S/C16H26BrN5O2Si/c1-25(2,3)8-7-24-10-22-16-13(14(17)21-22)15(18-9-19-16)20-11-5-4-6-12(11)23/h9,11-12,23H,4-8,10H2,1-3H3,(H,18,19,20)/t11-,12-/m1/s1 |
| InChIKey | LIXLKDPJQBKEEG-VXGBXAGGSA-N |
| XLogP | 3.23 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|