C25H34BrClN6O4Si — CID 140776926
N-[(2-bromo-5-chlorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 140776926) has the molecular formula C25H34BrClN6O4Si and a molecular weight of 626.03 g/mol. Its IUPAC name is N-[(2-bromo-5-chlorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | N-[(2-bromo-5-chlorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 140776926 |
| Molecular Formula | C25H34BrClN6O4Si |
| Molecular Weight | 626.03 g/mol |
| Exact Mass | 624.13 |
| IUPAC Name | N-[(2-bromo-5-chlorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | CN(Cc1cc(Cl)ccc1Br)C(=O)c1nn(COCC[Si](C)(C)C)c2ncnc(N[C@@H]3CC[C@@H](O)[C@H]3O)c12 |
| InChI | InChI=1S/C25H34BrClN6O4Si/c1-32(12-15-11-16(27)5-6-17(15)26)25(36)21-20-23(30-18-7-8-19(34)22(18)35)28-13-29-24(20)33(31-21)14-37-9-10-38(2,3)4/h5-6,11,13,18-19,22,34-35H,7-10,12,14H2,1-4H3,(H,28,29,30)/t18-,19-,22+/m1/s1 |
| InChIKey | BCCSRVMJUHXTDQ-KNKQGSTJSA-N |
| XLogP | 4.12 |
| TPSA | 125.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.03 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|