C19H21ClN6O3 — CID 126666818
N-[(3-chlorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 126666818) has the molecular formula C19H21ClN6O3 and a molecular weight of 416.87 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 126666818 |
| Molecular Formula | C19H21ClN6O3 |
| Molecular Weight | 416.87 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | CN(Cc1cccc(Cl)c1)C(=O)c1[nH]nc2ncnc(N[C@@H]3CC[C@@H](O)[C@H]3O)c12 |
| InChI | InChI=1S/C19H21ClN6O3/c1-26(8-10-3-2-4-11(20)7-10)19(29)15-14-17(21-9-22-18(14)25-24-15)23-12-5-6-13(27)16(12)28/h2-4,7,9,12-13,16,27-28H,5-6,8H2,1H3,(H2,21,22,23,24,25)/t12-,13-,16+/m1/s1 |
| InChIKey | GKHCOKCDZPQSLU-IOASZLSFSA-N |
| XLogP | 1.57 |
| TPSA | 127.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.87 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |