C20H20FN7O3 — CID 126667289
N-[(3-cyano-5-fluorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide (PubChem CID 126667289) has the molecular formula C20H20FN7O3 and a molecular weight of 425.42 g/mol. Its IUPAC name is N-[(3-cyano-5-fluorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide.
| Compound Name | N-[(3-cyano-5-fluorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 126667289 |
| Molecular Formula | C20H20FN7O3 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-[(3-cyano-5-fluorophenyl)methyl]-4-[[(1R,2S,3R)-2,3-dihydroxycyclopentyl]amino]-N-methyl-2H-pyrazolo[3,4-d]pyrimidine-3-carboxamide |
| SMILES | CN(Cc1cc(F)cc(C#N)c1)C(=O)c1[nH]nc2ncnc(N[C@@H]3CC[C@@H](O)[C@H]3O)c12 |
| InChI | InChI=1S/C20H20FN7O3/c1-28(8-11-4-10(7-22)5-12(21)6-11)20(31)16-15-18(23-9-24-19(15)27-26-16)25-13-2-3-14(29)17(13)30/h4-6,9,13-14,17,29-30H,2-3,8H2,1H3,(H2,23,24,25,26,27)/t13-,14-,17+/m1/s1 |
| InChIKey | TYGUGVYOLHIBGR-CPUCHLNUSA-N |
| XLogP | 0.93 |
| TPSA | 151.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |