C17H27N5O4Si — CID 140776895
4-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidine-3-carboxylic acid (PubChem CID 140776895) has the molecular formula C17H27N5O4Si and a molecular weight of 393.52 g/mol. Its IUPAC name is 4-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidine-3-carboxylic acid.
| Compound Name | 4-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidine-3-carboxylic acid |
|---|---|
| PubChem CID | 140776895 |
| Molecular Formula | C17H27N5O4Si |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 4-[[(1R,2R)-2-hydroxycyclopentyl]amino]-1-(2-trimethylsilylethoxymethyl)pyrazolo[3,4-d]pyrimidine-3-carboxylic acid |
| SMILES | C[Si](C)(C)CCOCn1nc(C(=O)O)c2c(N[C@@H]3CCC[C@H]3O)ncnc21 |
| InChI | InChI=1S/C17H27N5O4Si/c1-27(2,3)8-7-26-10-22-16-13(14(21-22)17(24)25)15(18-9-19-16)20-11-5-4-6-12(11)23/h9,11-12,23H,4-8,10H2,1-3H3,(H,24,25)(H,18,19,20)/t11-,12-/m1/s1 |
| InChIKey | PGTMGJIVVGWLCS-VXGBXAGGSA-N |
| XLogP | 2.16 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|