C17H28BrN3O2Si — CID 175726978
[(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methanone (PubChem CID 175726978) has the molecular formula C17H28BrN3O2Si and a molecular weight of 414.42 g/mol. Its IUPAC name is [(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methanone.
| Compound Name | [(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methanone |
|---|---|
| PubChem CID | 175726978 |
| Molecular Formula | C17H28BrN3O2Si |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | [(1S,5R)-8-azabicyclo[3.2.1]octan-8-yl]-[5-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]methanone |
| SMILES | C[Si](C)(C)CCOCn1nc(C(=O)N2[C@@H]3CCC[C@H]2CC3)cc1Br |
| InChI | InChI=1S/C17H28BrN3O2Si/c1-24(2,3)10-9-23-12-20-16(18)11-15(19-20)17(22)21-13-5-4-6-14(21)8-7-13/h11,13-14H,4-10,12H2,1-3H3/t13-,14+ |
| InChIKey | DGKNWNUVVUUOQL-OKILXGFUSA-N |
| XLogP | 4.11 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|