C23H38N4O4Si — CID 165152397
tert-butyl 6-[3-prop-1-en-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate (PubChem CID 165152397) has the molecular formula C23H38N4O4Si and a molecular weight of 462.67 g/mol. Its IUPAC name is tert-butyl 6-[3-prop-1-en-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate.
| Compound Name | tert-butyl 6-[3-prop-1-en-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate |
|---|---|
| PubChem CID | 165152397 |
| Molecular Formula | C23H38N4O4Si |
| Molecular Weight | 462.67 g/mol |
| Exact Mass | 462.27 |
| IUPAC Name | tert-butyl 6-[3-prop-1-en-2-yl-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbonyl]-2,6-diazaspiro[3.3]heptane-2-carboxylate |
| SMILES | C=C(C)c1cc(C(=O)N2CC3(CN(C(=O)OC(C)(C)C)C3)C2)n(COCC[Si](C)(C)C)n1 |
| InChI | InChI=1S/C23H38N4O4Si/c1-17(2)18-11-19(27(24-18)16-30-9-10-32(6,7)8)20(28)25-12-23(13-25)14-26(15-23)21(29)31-22(3,4)5/h11H,1,9-10,12-16H2,2-8H3 |
| InChIKey | QNNRCDHFYLQCQV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 76.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.67 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|