C23H33FN4O4Si — CID 175726871
[5-(5-fluoro-2-methoxy-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-(3-oxa-9-azabicyclo[3.3.1]nonan-9-yl)methanone (PubChem CID 175726871) has the molecular formula C23H33FN4O4Si and a molecular weight of 476.63 g/mol. Its IUPAC name is [5-(5-fluoro-2-methoxy-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-(3-oxa-9-azabicyclo[3.3.1]nonan-9-yl)methanone.
| Compound Name | [5-(5-fluoro-2-methoxy-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-(3-oxa-9-azabicyclo[3.3.1]nonan-9-yl)methanone |
|---|---|
| PubChem CID | 175726871 |
| Molecular Formula | C23H33FN4O4Si |
| Molecular Weight | 476.63 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | [5-(5-fluoro-2-methoxy-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-(3-oxa-9-azabicyclo[3.3.1]nonan-9-yl)methanone |
| SMILES | COc1cc(-c2cc(C(=O)N3C4CCCC3COC4)nn2COCC[Si](C)(C)C)c(F)cn1 |
| InChI | InChI=1S/C23H33FN4O4Si/c1-30-22-10-18(19(24)12-25-22)21-11-20(26-27(21)15-31-8-9-33(2,3)4)23(29)28-16-6-5-7-17(28)14-32-13-16/h10-12,16-17H,5-9,13-15H2,1-4H3 |
| InChIKey | OZIHWOQELMWINP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.63 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|