C22H33FN4O3Si — CID 175727158
[5-(5-fluoro-2-methoxy-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-(2-methylpiperidin-1-yl)methanone (PubChem CID 175727158) has the molecular formula C22H33FN4O3Si and a molecular weight of 448.62 g/mol. Its IUPAC name is [5-(5-fluoro-2-methoxy-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-(2-methylpiperidin-1-yl)methanone.
| Compound Name | [5-(5-fluoro-2-methoxy-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-(2-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 175727158 |
| Molecular Formula | C22H33FN4O3Si |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.23 |
| IUPAC Name | [5-(5-fluoro-2-methoxy-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]-(2-methylpiperidin-1-yl)methanone |
| SMILES | COc1cc(-c2cc(C(=O)N3CCCCC3C)nn2COCC[Si](C)(C)C)c(F)cn1 |
| InChI | InChI=1S/C22H33FN4O3Si/c1-16-8-6-7-9-26(16)22(28)19-13-20(17-12-21(29-2)24-14-18(17)23)27(25-19)15-30-10-11-31(3,4)5/h12-14,16H,6-11,15H2,1-5H3 |
| InChIKey | JTOJIAIBWVDGOM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|