C12H23BN2O3Si — CID 170903552
[5-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]boronic acid (PubChem CID 170903552) has the molecular formula C12H23BN2O3Si and a molecular weight of 282.22 g/mol. Its IUPAC name is [5-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]boronic acid.
| Compound Name | [5-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]boronic acid |
|---|---|
| PubChem CID | 170903552 |
| Molecular Formula | C12H23BN2O3Si |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | [5-cyclopropyl-1-(2-trimethylsilylethoxymethyl)pyrazol-3-yl]boronic acid |
| SMILES | C[Si](C)(C)CCOCn1nc(B(O)O)cc1C1CC1 |
| InChI | InChI=1S/C12H23BN2O3Si/c1-19(2,3)7-6-18-9-15-11(10-4-5-10)8-12(14-15)13(16)17/h8,10,16-17H,4-7,9H2,1-3H3 |
| InChIKey | VQUCNKSRXZDQNS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|