C21H28BrN3O6Si — CID 171853407
[(1R,3S)-3-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl] (4-nitrophenyl) carbonate (PubChem CID 171853407) has the molecular formula C21H28BrN3O6Si and a molecular weight of 526.46 g/mol. Its IUPAC name is [(1R,3S)-3-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl] (4-nitrophenyl) carbonate.
| Compound Name | [(1R,3S)-3-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 171853407 |
| Molecular Formula | C21H28BrN3O6Si |
| Molecular Weight | 526.46 g/mol |
| Exact Mass | 525.09 |
| IUPAC Name | [(1R,3S)-3-[3-bromo-1-(2-trimethylsilylethoxymethyl)pyrazol-5-yl]cyclopentyl] (4-nitrophenyl) carbonate |
| SMILES | C[Si](C)(C)CCOCn1nc(Br)cc1[C@H]1CC[C@@H](OC(=O)Oc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C21H28BrN3O6Si/c1-32(2,3)11-10-29-14-24-19(13-20(22)23-24)15-4-7-18(12-15)31-21(26)30-17-8-5-16(6-9-17)25(27)28/h5-6,8-9,13,15,18H,4,7,10-12,14H2,1-3H3/t15-,18+/m0/s1 |
| InChIKey | YHVHWAQTFTXEQN-MAUKXSAKSA-N |
| XLogP | 5.72 |
| TPSA | 105.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.46 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|