C27H31N5O7S — CID 170623899
[(1R,3S)-3-[1-tert-butyl-5-[(3-methyl-1,1-dioxo-2,3-dihydro-1,2-benzothiazol-5-yl)amino]pyrazol-3-yl]cyclopentyl] (4-nitrophenyl) carbonate (PubChem CID 170623899) has the molecular formula C27H31N5O7S and a molecular weight of 569.64 g/mol. Its IUPAC name is [(1R,3S)-3-[1-tert-butyl-5-[(3-methyl-1,1-dioxo-2,3-dihydro-1,2-benzothiazol-5-yl)amino]pyrazol-3-yl]cyclopentyl] (4-nitrophenyl) carbonate.
| Compound Name | [(1R,3S)-3-[1-tert-butyl-5-[(3-methyl-1,1-dioxo-2,3-dihydro-1,2-benzothiazol-5-yl)amino]pyrazol-3-yl]cyclopentyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 170623899 |
| Molecular Formula | C27H31N5O7S |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.19 |
| IUPAC Name | [(1R,3S)-3-[1-tert-butyl-5-[(3-methyl-1,1-dioxo-2,3-dihydro-1,2-benzothiazol-5-yl)amino]pyrazol-3-yl]cyclopentyl] (4-nitrophenyl) carbonate |
| SMILES | CC1NS(=O)(=O)c2ccc(Nc3cc([C@H]4CC[C@@H](OC(=O)Oc5ccc([N+](=O)[O-])cc5)C4)nn3C(C)(C)C)cc21 |
| InChI | InChI=1S/C27H31N5O7S/c1-16-22-14-18(6-12-24(22)40(36,37)30-16)28-25-15-23(29-31(25)27(2,3)4)17-5-9-21(13-17)39-26(33)38-20-10-7-19(8-11-20)32(34)35/h6-8,10-12,14-17,21,28,30H,5,9,13H2,1-4H3/t16?,17-,21+/m0/s1 |
| InChIKey | BEIUMYZQRMICQH-HBRZWPCVSA-N |
| XLogP | 5.49 |
| TPSA | 154.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|