C36H56N6O9S — CID 171794623
[(1R,3S)-3-[1-tert-butyl-3-[[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylsulfamoyl]cyclohexyl]amino]pyrazol-5-yl]cyclopentyl] (4-nitrophenyl) carbonate (PubChem CID 171794623) has the molecular formula C36H56N6O9S and a molecular weight of 748.94 g/mol. Its IUPAC name is [(1R,3S)-3-[1-tert-butyl-3-[[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylsulfamoyl]cyclohexyl]amino]pyrazol-5-yl]cyclopentyl] (4-nitrophenyl) carbonate.
| Compound Name | [(1R,3S)-3-[1-tert-butyl-3-[[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylsulfamoyl]cyclohexyl]amino]pyrazol-5-yl]cyclopentyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 171794623 |
| Molecular Formula | C36H56N6O9S |
| Molecular Weight | 748.94 g/mol |
| Exact Mass | 748.38 |
| IUPAC Name | [(1R,3S)-3-[1-tert-butyl-3-[[4-[6-[(2-methylpropan-2-yl)oxycarbonylamino]hexylsulfamoyl]cyclohexyl]amino]pyrazol-5-yl]cyclopentyl] (4-nitrophenyl) carbonate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNS(=O)(=O)C1CCC(Nc2cc([C@H]3CC[C@@H](OC(=O)Oc4ccc([N+](=O)[O-])cc4)C3)n(C(C)(C)C)n2)CC1 |
| InChI | InChI=1S/C36H56N6O9S/c1-35(2,3)41-31(25-11-16-29(23-25)50-34(44)49-28-17-14-27(15-18-28)42(45)46)24-32(40-41)39-26-12-19-30(20-13-26)52(47,48)38-22-10-8-7-9-21-37-33(43)51-36(4,5)6/h14-15,17-18,24-26,29-30,38H,7-13,16,19-23H2,1-6H3,(H,37,43)(H,39,40)/t25-,26?,29+,30?/m0/s1 |
| InChIKey | BZDSSFQTAJLXAT-YPQGXEFISA-N |
| XLogP | 7.13 |
| TPSA | 193.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.94 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|