C23H22N4O7 — CID 176898696
(4-nitrophenyl) [(1S,3R)-3-[3-(phenylmethoxycarbonylamino)-1H-pyrazol-5-yl]cyclopentyl] carbonate (PubChem CID 176898696) has the molecular formula C23H22N4O7 and a molecular weight of 466.45 g/mol. Its IUPAC name is (4-nitrophenyl) [(1S,3R)-3-[3-(phenylmethoxycarbonylamino)-1H-pyrazol-5-yl]cyclopentyl] carbonate.
| Compound Name | (4-nitrophenyl) [(1S,3R)-3-[3-(phenylmethoxycarbonylamino)-1H-pyrazol-5-yl]cyclopentyl] carbonate |
|---|---|
| PubChem CID | 176898696 |
| Molecular Formula | C23H22N4O7 |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | (4-nitrophenyl) [(1S,3R)-3-[3-(phenylmethoxycarbonylamino)-1H-pyrazol-5-yl]cyclopentyl] carbonate |
| SMILES | O=C(Nc1cc([C@@H]2CC[C@H](OC(=O)Oc3ccc([N+](=O)[O-])cc3)C2)[nH]n1)OCc1ccccc1 |
| InChI | InChI=1S/C23H22N4O7/c28-22(32-14-15-4-2-1-3-5-15)24-21-13-20(25-26-21)16-6-9-19(12-16)34-23(29)33-18-10-7-17(8-11-18)27(30)31/h1-5,7-8,10-11,13,16,19H,6,9,12,14H2,(H2,24,25,26,28)/t16-,19+/m1/s1 |
| InChIKey | PCBLUDLZHRFKSP-APWZRJJASA-N |
| XLogP | 4.92 |
| TPSA | 145.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|