C28H32N4O7S — CID 170623661
[3-[1-tert-butyl-5-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)amino]-4-methylpyrazol-3-yl]cyclopentyl] (4-nitrophenyl) carbonate (PubChem CID 170623661) has the molecular formula C28H32N4O7S and a molecular weight of 568.65 g/mol. Its IUPAC name is [3-[1-tert-butyl-5-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)amino]-4-methylpyrazol-3-yl]cyclopentyl] (4-nitrophenyl) carbonate.
| Compound Name | [3-[1-tert-butyl-5-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)amino]-4-methylpyrazol-3-yl]cyclopentyl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 170623661 |
| Molecular Formula | C28H32N4O7S |
| Molecular Weight | 568.65 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | [3-[1-tert-butyl-5-[(1,1-dioxo-2,3-dihydro-1-benzothiophen-5-yl)amino]-4-methylpyrazol-3-yl]cyclopentyl] (4-nitrophenyl) carbonate |
| SMILES | Cc1c(C2CCC(OC(=O)Oc3ccc([N+](=O)[O-])cc3)C2)nn(C(C)(C)C)c1Nc1ccc2c(c1)CCS2(=O)=O |
| InChI | InChI=1S/C28H32N4O7S/c1-17-25(19-5-9-23(16-19)39-27(33)38-22-10-7-21(8-11-22)32(34)35)30-31(28(2,3)4)26(17)29-20-6-12-24-18(15-20)13-14-40(24,36)37/h6-8,10-12,15,19,23,29H,5,9,13-14,16H2,1-4H3 |
| InChIKey | ZJVNWKGGMRFQRR-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 142.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|