C27H32N4O4S — CID 177150678
1-tert-butyl-5-[4-(4-nitrophenoxy)cyclohexyl]-N-(1-oxo-2,3-dihydro-1-benzothiophen-6-yl)pyrazol-3-amine (PubChem CID 177150678) has the molecular formula C27H32N4O4S and a molecular weight of 508.64 g/mol. Its IUPAC name is 1-tert-butyl-5-[4-(4-nitrophenoxy)cyclohexyl]-N-(1-oxo-2,3-dihydro-1-benzothiophen-6-yl)pyrazol-3-amine.
| Compound Name | 1-tert-butyl-5-[4-(4-nitrophenoxy)cyclohexyl]-N-(1-oxo-2,3-dihydro-1-benzothiophen-6-yl)pyrazol-3-amine |
|---|---|
| PubChem CID | 177150678 |
| Molecular Formula | C27H32N4O4S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 1-tert-butyl-5-[4-(4-nitrophenoxy)cyclohexyl]-N-(1-oxo-2,3-dihydro-1-benzothiophen-6-yl)pyrazol-3-amine |
| SMILES | CC(C)(C)n1nc(Nc2ccc3c(c2)S(=O)CC3)cc1C1CCC(Oc2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C27H32N4O4S/c1-27(2,3)30-24(17-26(29-30)28-20-7-4-19-14-15-36(34)25(19)16-20)18-5-10-22(11-6-18)35-23-12-8-21(9-13-23)31(32)33/h4,7-9,12-13,16-18,22H,5-6,10-11,14-15H2,1-3H3,(H,28,29) |
| InChIKey | FCKUIFYRUJECES-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|