C13H13NO7 — CID 163335381
[(3aS,4R,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate (PubChem CID 163335381) has the molecular formula C13H13NO7 and a molecular weight of 295.25 g/mol. Its IUPAC name is [(3aS,4R,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate.
| Compound Name | [(3aS,4R,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate |
|---|---|
| PubChem CID | 163335381 |
| Molecular Formula | C13H13NO7 |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | [(3aS,4R,6aS)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrophenyl) carbonate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1)O[C@H]1CO[C@@H]2OCC[C@H]21 |
| InChI | InChI=1S/C13H13NO7/c15-13(20-9-3-1-8(2-4-9)14(16)17)21-11-7-19-12-10(11)5-6-18-12/h1-4,10-12H,5-7H2/t10-,11-,12-/m0/s1 |
| InChIKey | ULTSJNOQNKVDBM-SRVKXCTJSA-N |
| XLogP | 1.87 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|