C13H13NO6 — CID 89234953
[(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrosophenyl) carbonate (PubChem CID 89234953) has the molecular formula C13H13NO6 and a molecular weight of 279.25 g/mol. Its IUPAC name is [(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrosophenyl) carbonate.
| Compound Name | [(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrosophenyl) carbonate |
|---|---|
| PubChem CID | 89234953 |
| Molecular Formula | C13H13NO6 |
| Molecular Weight | 279.25 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | [(4R)-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] (4-nitrosophenyl) carbonate |
| SMILES | O=Nc1ccc(OC(=O)O[C@H]2COC3OCCC32)cc1 |
| InChI | InChI=1S/C13H13NO6/c15-13(19-9-3-1-8(14-16)2-4-9)20-11-7-18-12-10(11)5-6-17-12/h1-4,10-12H,5-7H2/t10?,11-,12?/m0/s1 |
| InChIKey | OQHYLZRFUCDCQT-CXQJBGSLSA-N |
| XLogP | 2.36 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|