C25H24N2O11 — CID 22499824
bis[2-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl)-4-nitrophenyl] carbonate (PubChem CID 22499824) has the molecular formula C25H24N2O11 and a molecular weight of 528.47 g/mol. Its IUPAC name is bis[2-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl)-4-nitrophenyl] carbonate.
| Compound Name | bis[2-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl)-4-nitrophenyl] carbonate |
|---|---|
| PubChem CID | 22499824 |
| Molecular Formula | C25H24N2O11 |
| Molecular Weight | 528.47 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | bis[2-(2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl)-4-nitrophenyl] carbonate |
| SMILES | O=C(Oc1ccc([N+](=O)[O-])cc1C1COC2OCCC21)Oc1ccc([N+](=O)[O-])cc1C1COC2OCCC21 |
| InChI | InChI=1S/C25H24N2O11/c28-25(37-21-3-1-13(26(29)30)9-17(21)19-11-35-23-15(19)5-7-33-23)38-22-4-2-14(27(31)32)10-18(22)20-12-36-24-16(20)6-8-34-24/h1-4,9-10,15-16,19-20,23-24H,5-8,11-12H2 |
| InChIKey | UMOBFSUXAXFJGR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 158.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.47 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|