C31H30N8O7 — CID 177305894
bis[2-[3-(2-aminopyrimidin-5-yl)cyclopentyl]-4-nitrophenyl] carbonate (PubChem CID 177305894) has the molecular formula C31H30N8O7 and a molecular weight of 626.63 g/mol. Its IUPAC name is bis[2-[3-(2-aminopyrimidin-5-yl)cyclopentyl]-4-nitrophenyl] carbonate.
| Compound Name | bis[2-[3-(2-aminopyrimidin-5-yl)cyclopentyl]-4-nitrophenyl] carbonate |
|---|---|
| PubChem CID | 177305894 |
| Molecular Formula | C31H30N8O7 |
| Molecular Weight | 626.63 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | bis[2-[3-(2-aminopyrimidin-5-yl)cyclopentyl]-4-nitrophenyl] carbonate |
| SMILES | Nc1ncc(C2CCC(c3cc([N+](=O)[O-])ccc3OC(=O)Oc3ccc([N+](=O)[O-])cc3C3CCC(c4cnc(N)nc4)C3)C2)cn1 |
| InChI | InChI=1S/C31H30N8O7/c32-29-34-13-21(14-35-29)17-1-3-19(9-17)25-11-23(38(41)42)5-7-27(25)45-31(40)46-28-8-6-24(39(43)44)12-26(28)20-4-2-18(10-20)22-15-36-30(33)37-16-22/h5-8,11-20H,1-4,9-10H2,(H2,32,34,35)(H2,33,36,37) |
| InChIKey | BLAPHGSEOGJOBK-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 225.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.63 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|